C20H30N6O — CID 111185994
N-ethyl-4-(2-hydroxyphenyl)-N'-[3-(5-methyl-1H-pyrazol-4-yl)propyl]piperazine-1-carboximidamide (PubChem CID 111185994) has the molecular formula C20H30N6O and a molecular weight of 370.50 g/mol. Its IUPAC name is N-ethyl-4-(2-hydroxyphenyl)-N'-[3-(5-methyl-1H-pyrazol-4-yl)propyl]piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(2-hydroxyphenyl)-N'-[3-(5-methyl-1H-pyrazol-4-yl)propyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111185994 |
| Molecular Formula | C20H30N6O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | N-ethyl-4-(2-hydroxyphenyl)-N'-[3-(5-methyl-1H-pyrazol-4-yl)propyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCc1cn[nH]c1C)N1CCN(c2ccccc2O)CC1 |
| InChI | InChI=1S/C20H30N6O/c1-3-21-20(22-10-6-7-17-15-23-24-16(17)2)26-13-11-25(12-14-26)18-8-4-5-9-19(18)27/h4-5,8-9,15,27H,3,6-7,10-14H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | MKYXBJHRNXFPJL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|