C22H35N5O3 — CID 111163549
ethyl 4-[N-ethyl-N'-[[3-(2-methylbutanoylamino)phenyl]methyl]carbamimidoyl]piperazine-1-carboxylate (PubChem CID 111163549) has the molecular formula C22H35N5O3 and a molecular weight of 417.55 g/mol. Its IUPAC name is ethyl 4-[N-ethyl-N'-[[3-(2-methylbutanoylamino)phenyl]methyl]carbamimidoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[N-ethyl-N'-[[3-(2-methylbutanoylamino)phenyl]methyl]carbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111163549 |
| Molecular Formula | C22H35N5O3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | ethyl 4-[N-ethyl-N'-[[3-(2-methylbutanoylamino)phenyl]methyl]carbamimidoyl]piperazine-1-carboxylate |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)C(C)CC)c1)N1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C22H35N5O3/c1-5-17(4)20(28)25-19-10-8-9-18(15-19)16-24-21(23-6-2)26-11-13-27(14-12-26)22(29)30-7-3/h8-10,15,17H,5-7,11-14,16H2,1-4H3,(H,23,24)(H,25,28) |
| InChIKey | BDVLQKSIKHDHPB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|