C24H31IN6O2 — CID 111268794
N-ethyl-6,7-dimethoxy-N'-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide (PubChem CID 111268794) has the molecular formula C24H31IN6O2 and a molecular weight of 562.46 g/mol. Its IUPAC name is N-ethyl-6,7-dimethoxy-N'-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-6,7-dimethoxy-N'-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111268794 |
| Molecular Formula | C24H31IN6O2 |
| Molecular Weight | 562.46 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | N-ethyl-6,7-dimethoxy-N'-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(Cn2cncn2)c1)N1CCc2cc(OC)c(OC)cc2C1.I |
| InChI | InChI=1S/C24H30N6O2.HI/c1-4-26-24(27-13-18-6-5-7-19(10-18)14-30-17-25-16-28-30)29-9-8-20-11-22(31-2)23(32-3)12-21(20)15-29;/h5-7,10-12,16-17H,4,8-9,13-15H2,1-3H3,(H,26,27);1H |
| InChIKey | JSWHAYPRIDSYKR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 76.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|