C23H31IN6O2 — CID 111296260
1-[(2,4-dimethoxyphenyl)methyl]-3-ethyl-1-methyl-2-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111296260) has the molecular formula C23H31IN6O2 and a molecular weight of 550.45 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-3-ethyl-1-methyl-2-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-3-ethyl-1-methyl-2-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111296260 |
| Molecular Formula | C23H31IN6O2 |
| Molecular Weight | 550.45 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-3-ethyl-1-methyl-2-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(Cn2cncn2)c1)N(C)Cc1ccc(OC)cc1OC.I |
| InChI | InChI=1S/C23H30N6O2.HI/c1-5-25-23(28(2)15-20-9-10-21(30-3)12-22(20)31-4)26-13-18-7-6-8-19(11-18)14-29-17-24-16-27-29;/h6-12,16-17H,5,13-15H2,1-4H3,(H,25,26);1H |
| InChIKey | FAEPOHGISGWFJJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 76.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|