C23H30N4O4 — CID 111984063
2-[3-[[[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(ethylamino)methylidene]amino]methyl]phenoxy]acetamide (PubChem CID 111984063) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is 2-[3-[[[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(ethylamino)methylidene]amino]methyl]phenoxy]acetamide.
| Compound Name | 2-[3-[[[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(ethylamino)methylidene]amino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 111984063 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 2-[3-[[[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(ethylamino)methylidene]amino]methyl]phenoxy]acetamide |
| SMILES | CCN/C(=N\Cc1cccc(OCC(N)=O)c1)N1CCc2cc(OC)c(OC)cc2C1 |
| InChI | InChI=1S/C23H30N4O4/c1-4-25-23(26-13-16-6-5-7-19(10-16)31-15-22(24)28)27-9-8-17-11-20(29-2)21(30-3)12-18(17)14-27/h5-7,10-12H,4,8-9,13-15H2,1-3H3,(H2,24,28)(H,25,26) |
| InChIKey | MDDMMLHPORRKLR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|