C23H27FN6O — CID 111133247
N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-4-(2-methoxyphenyl)-N'-methylpiperazine-1-carboximidamide (PubChem CID 111133247) has the molecular formula C23H27FN6O and a molecular weight of 422.51 g/mol. Its IUPAC name is N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-4-(2-methoxyphenyl)-N'-methylpiperazine-1-carboximidamide.
| Compound Name | N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-4-(2-methoxyphenyl)-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111133247 |
| Molecular Formula | C23H27FN6O |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-4-(2-methoxyphenyl)-N'-methylpiperazine-1-carboximidamide |
| SMILES | C/N=C(/NCc1ccc(-n2ccnc2)c(F)c1)N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C23H27FN6O/c1-25-23(27-16-18-7-8-20(19(24)15-18)30-10-9-26-17-30)29-13-11-28(12-14-29)21-5-3-4-6-22(21)31-2/h3-10,15,17H,11-14,16H2,1-2H3,(H,25,27) |
| InChIKey | OIEAPLPQYKNAOR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 57.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|