C24H35IN6O2 — CID 111133546
2-(dimethylamino)-N-[3-[[[C-[4-(2-methoxyphenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]phenyl]acetamide;hydroiodide (PubChem CID 111133546) has the molecular formula C24H35IN6O2 and a molecular weight of 566.49 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[3-[[[C-[4-(2-methoxyphenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]phenyl]acetamide;hydroiodide.
| Compound Name | 2-(dimethylamino)-N-[3-[[[C-[4-(2-methoxyphenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]phenyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111133546 |
| Molecular Formula | C24H35IN6O2 |
| Molecular Weight | 566.49 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | 2-(dimethylamino)-N-[3-[[[C-[4-(2-methoxyphenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]phenyl]acetamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(NC(=O)CN(C)C)c1)N1CCN(c2ccccc2OC)CC1.I |
| InChI | InChI=1S/C24H34N6O2.HI/c1-25-24(26-17-19-8-7-9-20(16-19)27-23(31)18-28(2)3)30-14-12-29(13-15-30)21-10-5-6-11-22(21)32-4;/h5-11,16H,12-15,17-18H2,1-4H3,(H,25,26)(H,27,31);1H |
| InChIKey | ORHPJQNXOWTVLV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|