C23H31ClN6O — CID 111186647
N-[3-[[[C-[4-(3-chlorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]phenyl]-2-(dimethylamino)acetamide (PubChem CID 111186647) has the molecular formula C23H31ClN6O and a molecular weight of 443.00 g/mol. Its IUPAC name is N-[3-[[[C-[4-(3-chlorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]phenyl]-2-(dimethylamino)acetamide.
| Compound Name | N-[3-[[[C-[4-(3-chlorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]phenyl]-2-(dimethylamino)acetamide |
|---|---|
| PubChem CID | 111186647 |
| Molecular Formula | C23H31ClN6O |
| Molecular Weight | 443.00 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | N-[3-[[[C-[4-(3-chlorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]phenyl]-2-(dimethylamino)acetamide |
| SMILES | C/N=C(\NCc1cccc(NC(=O)CN(C)C)c1)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C23H31ClN6O/c1-25-23(30-12-10-29(11-13-30)21-9-5-7-19(24)15-21)26-16-18-6-4-8-20(14-18)27-22(31)17-28(2)3/h4-9,14-15H,10-13,16-17H2,1-3H3,(H,25,26)(H,27,31) |
| InChIKey | LORRMKFHIIRFGI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.00 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|