C24H34IN5O — CID 111725346
N-[3-[[[C-(3-benzylpyrrolidin-1-yl)-N-methylcarbonimidoyl]amino]methyl]phenyl]-2-(dimethylamino)acetamide;hydroiodide (PubChem CID 111725346) has the molecular formula C24H34IN5O and a molecular weight of 535.47 g/mol. Its IUPAC name is N-[3-[[[C-(3-benzylpyrrolidin-1-yl)-N-methylcarbonimidoyl]amino]methyl]phenyl]-2-(dimethylamino)acetamide;hydroiodide.
| Compound Name | N-[3-[[[C-(3-benzylpyrrolidin-1-yl)-N-methylcarbonimidoyl]amino]methyl]phenyl]-2-(dimethylamino)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111725346 |
| Molecular Formula | C24H34IN5O |
| Molecular Weight | 535.47 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | N-[3-[[[C-(3-benzylpyrrolidin-1-yl)-N-methylcarbonimidoyl]amino]methyl]phenyl]-2-(dimethylamino)acetamide;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(NC(=O)CN(C)C)c1)N1CCC(Cc2ccccc2)C1.I |
| InChI | InChI=1S/C24H33N5O.HI/c1-25-24(29-13-12-21(17-29)14-19-8-5-4-6-9-19)26-16-20-10-7-11-22(15-20)27-23(30)18-28(2)3;/h4-11,15,21H,12-14,16-18H2,1-3H3,(H,25,26)(H,27,30);1H |
| InChIKey | GOGKMJVTBPNLRO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|