C20H24N2O3S — CID 110294078
2-(4-tert-butylbenzoyl)-3,4-dihydro-1H-isoquinoline-7-sulfonamide (PubChem CID 110294078) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is 2-(4-tert-butylbenzoyl)-3,4-dihydro-1H-isoquinoline-7-sulfonamide.
| Compound Name | 2-(4-tert-butylbenzoyl)-3,4-dihydro-1H-isoquinoline-7-sulfonamide |
|---|---|
| PubChem CID | 110294078 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 2-(4-tert-butylbenzoyl)-3,4-dihydro-1H-isoquinoline-7-sulfonamide |
| SMILES | CC(C)(C)c1ccc(C(=O)N2CCc3ccc(S(N)(=O)=O)cc3C2)cc1 |
| InChI | InChI=1S/C20H24N2O3S/c1-20(2,3)17-7-4-15(5-8-17)19(23)22-11-10-14-6-9-18(26(21,24)25)12-16(14)13-22/h4-9,12H,10-11,13H2,1-3H3,(H2,21,24,25) |
| InChIKey | GROMXLDHLCXOON-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |