C16H22N2O3S — CID 110294055
2-(cyclohexanecarbonyl)-3,4-dihydro-1H-isoquinoline-7-sulfonamide (PubChem CID 110294055) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is 2-(cyclohexanecarbonyl)-3,4-dihydro-1H-isoquinoline-7-sulfonamide.
| Compound Name | 2-(cyclohexanecarbonyl)-3,4-dihydro-1H-isoquinoline-7-sulfonamide |
|---|---|
| PubChem CID | 110294055 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 2-(cyclohexanecarbonyl)-3,4-dihydro-1H-isoquinoline-7-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)CN(C(=O)C1CCCCC1)CC2 |
| InChI | InChI=1S/C16H22N2O3S/c17-22(20,21)15-7-6-12-8-9-18(11-14(12)10-15)16(19)13-4-2-1-3-5-13/h6-7,10,13H,1-5,8-9,11H2,(H2,17,20,21) |
| InChIKey | JUWFKHATKRTCGO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |