C15H16N2O2 — CID 66000688
1-(5-amino-1,3-dihydroisoindol-2-yl)-3-(furan-2-yl)propan-1-one (PubChem CID 66000688) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is 1-(5-amino-1,3-dihydroisoindol-2-yl)-3-(furan-2-yl)propan-1-one.
| Compound Name | 1-(5-amino-1,3-dihydroisoindol-2-yl)-3-(furan-2-yl)propan-1-one |
|---|---|
| PubChem CID | 66000688 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 1-(5-amino-1,3-dihydroisoindol-2-yl)-3-(furan-2-yl)propan-1-one |
| SMILES | Nc1ccc2c(c1)CN(C(=O)CCc1ccco1)C2 |
| InChI | InChI=1S/C15H16N2O2/c16-13-4-3-11-9-17(10-12(11)8-13)15(18)6-5-14-2-1-7-19-14/h1-4,7-8H,5-6,9-10,16H2 |
| InChIKey | HDFHROHVRNDZLZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|