C15H15BrN2O4S — CID 16944023
1-bromo-N-[2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinolin-7-yl]methanesulfonamide (PubChem CID 16944023) has the molecular formula C15H15BrN2O4S and a molecular weight of 399.27 g/mol. Its IUPAC name is 1-bromo-N-[2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinolin-7-yl]methanesulfonamide.
| Compound Name | 1-bromo-N-[2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinolin-7-yl]methanesulfonamide |
|---|---|
| PubChem CID | 16944023 |
| Molecular Formula | C15H15BrN2O4S |
| Molecular Weight | 399.27 g/mol |
| Exact Mass | 397.99 |
| IUPAC Name | 1-bromo-N-[2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinolin-7-yl]methanesulfonamide |
| SMILES | O=C(c1ccco1)N1CCc2ccc(NS(=O)(=O)CBr)cc2C1 |
| InChI | InChI=1S/C15H15BrN2O4S/c16-10-23(20,21)17-13-4-3-11-5-6-18(9-12(11)8-13)15(19)14-2-1-7-22-14/h1-4,7-8,17H,5-6,9-10H2 |
| InChIKey | MIMIYEWAZUBYRS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|