C10H14N2O2S — CID 28707249
2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-7-amine (PubChem CID 28707249) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is 2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-7-amine.
| Compound Name | 2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-7-amine |
|---|---|
| PubChem CID | 28707249 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-7-amine |
| SMILES | CS(=O)(=O)N1CCc2ccc(N)cc2C1 |
| InChI | InChI=1S/C10H14N2O2S/c1-15(13,14)12-5-4-8-2-3-10(11)6-9(8)7-12/h2-3,6H,4-5,7,11H2,1H3 |
| InChIKey | XKQPKSBAPXVCOK-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|