C15H23N3O3S — CID 110664308
1-tert-butyl-3-(2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-7-yl)urea (PubChem CID 110664308) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is 1-tert-butyl-3-(2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-7-yl)urea.
| Compound Name | 1-tert-butyl-3-(2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-7-yl)urea |
|---|---|
| PubChem CID | 110664308 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 1-tert-butyl-3-(2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-7-yl)urea |
| SMILES | CC(C)(C)NC(=O)Nc1ccc2c(c1)CN(S(C)(=O)=O)CC2 |
| InChI | InChI=1S/C15H23N3O3S/c1-15(2,3)17-14(19)16-13-6-5-11-7-8-18(22(4,20)21)10-12(11)9-13/h5-6,9H,7-8,10H2,1-4H3,(H2,16,17,19) |
| InChIKey | WDDZDVVNVVXBOJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |