C17H17ClN2O3S — CID 16930051
3-chloro-N-(2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-7-yl)benzamide (PubChem CID 16930051) has the molecular formula C17H17ClN2O3S and a molecular weight of 364.85 g/mol. Its IUPAC name is 3-chloro-N-(2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-7-yl)benzamide.
| Compound Name | 3-chloro-N-(2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-7-yl)benzamide |
|---|---|
| PubChem CID | 16930051 |
| Molecular Formula | C17H17ClN2O3S |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 3-chloro-N-(2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-7-yl)benzamide |
| SMILES | CS(=O)(=O)N1CCc2ccc(NC(=O)c3cccc(Cl)c3)cc2C1 |
| InChI | InChI=1S/C17H17ClN2O3S/c1-24(22,23)20-8-7-12-5-6-16(10-14(12)11-20)19-17(21)13-3-2-4-15(18)9-13/h2-6,9-10H,7-8,11H2,1H3,(H,19,21) |
| InChIKey | IMZBRKOMBBRTSZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |