C20H17ClN2O3S2 — CID 16930636
3-chloro-N-(2-thiophen-2-ylsulfonyl-3,4-dihydro-1H-isoquinolin-7-yl)benzamide (PubChem CID 16930636) has the molecular formula C20H17ClN2O3S2 and a molecular weight of 432.95 g/mol. Its IUPAC name is 3-chloro-N-(2-thiophen-2-ylsulfonyl-3,4-dihydro-1H-isoquinolin-7-yl)benzamide.
| Compound Name | 3-chloro-N-(2-thiophen-2-ylsulfonyl-3,4-dihydro-1H-isoquinolin-7-yl)benzamide |
|---|---|
| PubChem CID | 16930636 |
| Molecular Formula | C20H17ClN2O3S2 |
| Molecular Weight | 432.95 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | 3-chloro-N-(2-thiophen-2-ylsulfonyl-3,4-dihydro-1H-isoquinolin-7-yl)benzamide |
| SMILES | O=C(Nc1ccc2c(c1)CN(S(=O)(=O)c1cccs1)CC2)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H17ClN2O3S2/c21-17-4-1-3-15(11-17)20(24)22-18-7-6-14-8-9-23(13-16(14)12-18)28(25,26)19-5-2-10-27-19/h1-7,10-12H,8-9,13H2,(H,22,24) |
| InChIKey | GUEHYGPQILCUIO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.95 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |