C23H26N4O — CID 46963658
N-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-4-methyl-3-phenyl-1H-pyrazole-5-carboxamide (PubChem CID 46963658) has the molecular formula C23H26N4O and a molecular weight of 374.49 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-4-methyl-3-phenyl-1H-pyrazole-5-carboxamide.
| Compound Name | N-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-4-methyl-3-phenyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 46963658 |
| Molecular Formula | C23H26N4O |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | N-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-4-methyl-3-phenyl-1H-pyrazole-5-carboxamide |
| SMILES | Cc1c(-c2ccccc2)n[nH]c1C(=O)NCCCN1CCCc2ccccc21 |
| InChI | InChI=1S/C23H26N4O/c1-17-21(19-10-3-2-4-11-19)25-26-22(17)23(28)24-14-8-16-27-15-7-12-18-9-5-6-13-20(18)27/h2-6,9-11,13H,7-8,12,14-16H2,1H3,(H,24,28)(H,25,26) |
| InChIKey | GDNOCUJSBZUCFG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|