C26H30N2S2 — CID 100746717
1-[(1R)-1-(2,4-dimethylphenyl)-2-methylpropyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea (PubChem CID 100746717) has the molecular formula C26H30N2S2 and a molecular weight of 434.67 g/mol. Its IUPAC name is 1-[(1R)-1-(2,4-dimethylphenyl)-2-methylpropyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea.
| Compound Name | 1-[(1R)-1-(2,4-dimethylphenyl)-2-methylpropyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 100746717 |
| Molecular Formula | C26H30N2S2 |
| Molecular Weight | 434.67 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 1-[(1R)-1-(2,4-dimethylphenyl)-2-methylpropyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea |
| SMILES | Cc1ccc([C@H](NC(=S)Nc2ccc(CSc3ccccc3)cc2)C(C)C)c(C)c1 |
| InChI | InChI=1S/C26H30N2S2/c1-18(2)25(24-15-10-19(3)16-20(24)4)28-26(29)27-22-13-11-21(12-14-22)17-30-23-8-6-5-7-9-23/h5-16,18,25H,17H2,1-4H3,(H2,27,28,29)/t25-/m1/s1 |
| InChIKey | NQXMSWIFBBYUES-RUZDIDTESA-N |
| XLogP | 7.28 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.67 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|