C23H28N4OS — CID 133216249
1-[3-(2-oxopyrrolidin-1-yl)phenyl]-3-[1-(4-pyrrolidin-1-ylphenyl)ethyl]thiourea (PubChem CID 133216249) has the molecular formula C23H28N4OS and a molecular weight of 408.57 g/mol. Its IUPAC name is 1-[3-(2-oxopyrrolidin-1-yl)phenyl]-3-[1-(4-pyrrolidin-1-ylphenyl)ethyl]thiourea.
| Compound Name | 1-[3-(2-oxopyrrolidin-1-yl)phenyl]-3-[1-(4-pyrrolidin-1-ylphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 133216249 |
| Molecular Formula | C23H28N4OS |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 1-[3-(2-oxopyrrolidin-1-yl)phenyl]-3-[1-(4-pyrrolidin-1-ylphenyl)ethyl]thiourea |
| SMILES | CC(NC(=S)Nc1cccc(N2CCCC2=O)c1)c1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C23H28N4OS/c1-17(18-9-11-20(12-10-18)26-13-2-3-14-26)24-23(29)25-19-6-4-7-21(16-19)27-15-5-8-22(27)28/h4,6-7,9-12,16-17H,2-3,5,8,13-15H2,1H3,(H2,24,25,29) |
| InChIKey | NREJFMLPTOHSMW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|