C26H27N3OS — CID 100747696
1-[(S)-(2,4-dimethylphenyl)-phenylmethyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]thiourea (PubChem CID 100747696) has the molecular formula C26H27N3OS and a molecular weight of 429.59 g/mol. Its IUPAC name is 1-[(S)-(2,4-dimethylphenyl)-phenylmethyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]thiourea.
| Compound Name | 1-[(S)-(2,4-dimethylphenyl)-phenylmethyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 100747696 |
| Molecular Formula | C26H27N3OS |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 1-[(S)-(2,4-dimethylphenyl)-phenylmethyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]thiourea |
| SMILES | Cc1ccc([C@@H](NC(=S)Nc2ccc(N3CCCC3=O)cc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C26H27N3OS/c1-18-10-15-23(19(2)17-18)25(20-7-4-3-5-8-20)28-26(31)27-21-11-13-22(14-12-21)29-16-6-9-24(29)30/h3-5,7-8,10-15,17,25H,6,9,16H2,1-2H3,(H2,27,28,31)/t25-/m0/s1 |
| InChIKey | QSBGFRVSWZXFQN-VWLOTQADSA-N |
| XLogP | 5.51 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|