C24H31N3OS — CID 133218221
1-[1-(2,4-dimethylphenyl)-2-methylpropyl]-3-[4-methyl-3-(2-oxopyrrolidin-1-yl)phenyl]thiourea (PubChem CID 133218221) has the molecular formula C24H31N3OS and a molecular weight of 409.60 g/mol. Its IUPAC name is 1-[1-(2,4-dimethylphenyl)-2-methylpropyl]-3-[4-methyl-3-(2-oxopyrrolidin-1-yl)phenyl]thiourea.
| Compound Name | 1-[1-(2,4-dimethylphenyl)-2-methylpropyl]-3-[4-methyl-3-(2-oxopyrrolidin-1-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 133218221 |
| Molecular Formula | C24H31N3OS |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 1-[1-(2,4-dimethylphenyl)-2-methylpropyl]-3-[4-methyl-3-(2-oxopyrrolidin-1-yl)phenyl]thiourea |
| SMILES | Cc1ccc(C(NC(=S)Nc2ccc(C)c(N3CCCC3=O)c2)C(C)C)c(C)c1 |
| InChI | InChI=1S/C24H31N3OS/c1-15(2)23(20-11-8-16(3)13-18(20)5)26-24(29)25-19-10-9-17(4)21(14-19)27-12-6-7-22(27)28/h8-11,13-15,23H,6-7,12H2,1-5H3,(H2,25,26,29) |
| InChIKey | YZOGWZCYBQYRTQ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|