C22H27N3O2S — CID 100707376
1-[4-methyl-3-(2-oxopyrrolidin-1-yl)phenyl]-3-[(2R)-1-(2-methylphenoxy)propan-2-yl]thiourea (PubChem CID 100707376) has the molecular formula C22H27N3O2S and a molecular weight of 397.54 g/mol. Its IUPAC name is 1-[4-methyl-3-(2-oxopyrrolidin-1-yl)phenyl]-3-[(2R)-1-(2-methylphenoxy)propan-2-yl]thiourea.
| Compound Name | 1-[4-methyl-3-(2-oxopyrrolidin-1-yl)phenyl]-3-[(2R)-1-(2-methylphenoxy)propan-2-yl]thiourea |
|---|---|
| PubChem CID | 100707376 |
| Molecular Formula | C22H27N3O2S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 1-[4-methyl-3-(2-oxopyrrolidin-1-yl)phenyl]-3-[(2R)-1-(2-methylphenoxy)propan-2-yl]thiourea |
| SMILES | Cc1ccccc1OC[C@@H](C)NC(=S)Nc1ccc(C)c(N2CCCC2=O)c1 |
| InChI | InChI=1S/C22H27N3O2S/c1-15-10-11-18(13-19(15)25-12-6-9-21(25)26)24-22(28)23-17(3)14-27-20-8-5-4-7-16(20)2/h4-5,7-8,10-11,13,17H,6,9,12,14H2,1-3H3,(H2,23,24,28)/t17-/m1/s1 |
| InChIKey | DTRQESBZCSHABD-QGZVFWFLSA-N |
| XLogP | 4.18 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|