C25H27N3OS — CID 133218298
4-[[(2,4-dimethylphenyl)-phenylmethyl]carbamothioylamino]-N,N-dimethylbenzamide (PubChem CID 133218298) has the molecular formula C25H27N3OS and a molecular weight of 417.58 g/mol. Its IUPAC name is 4-[[(2,4-dimethylphenyl)-phenylmethyl]carbamothioylamino]-N,N-dimethylbenzamide.
| Compound Name | 4-[[(2,4-dimethylphenyl)-phenylmethyl]carbamothioylamino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 133218298 |
| Molecular Formula | C25H27N3OS |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 4-[[(2,4-dimethylphenyl)-phenylmethyl]carbamothioylamino]-N,N-dimethylbenzamide |
| SMILES | Cc1ccc(C(NC(=S)Nc2ccc(C(=O)N(C)C)cc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C25H27N3OS/c1-17-10-15-22(18(2)16-17)23(19-8-6-5-7-9-19)27-25(30)26-21-13-11-20(12-14-21)24(29)28(3)4/h5-16,23H,1-4H3,(H2,26,27,30) |
| InChIKey | SXPSSYCPSXFNIM-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|