C23H29N3OS — CID 100731644
1-[(1S)-1-(3,4-dimethylphenyl)propyl]-3-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]thiourea (PubChem CID 100731644) has the molecular formula C23H29N3OS and a molecular weight of 395.57 g/mol. Its IUPAC name is 1-[(1S)-1-(3,4-dimethylphenyl)propyl]-3-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]thiourea.
| Compound Name | 1-[(1S)-1-(3,4-dimethylphenyl)propyl]-3-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 100731644 |
| Molecular Formula | C23H29N3OS |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 1-[(1S)-1-(3,4-dimethylphenyl)propyl]-3-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]thiourea |
| SMILES | CC[C@H](NC(=S)Nc1ccc(N2CCCC2=O)c(C)c1)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C23H29N3OS/c1-5-20(18-9-8-15(2)16(3)13-18)25-23(28)24-19-10-11-21(17(4)14-19)26-12-6-7-22(26)27/h8-11,13-14,20H,5-7,12H2,1-4H3,(H2,24,25,28)/t20-/m0/s1 |
| InChIKey | XOMRPOGSJDHCSE-FQEVSTJZSA-N |
| XLogP | 5.18 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|