C21H25N3O4S — CID 100683608
1-[3-(2-oxopyrrolidin-1-yl)phenyl]-3-[(3,4,5-trimethoxyphenyl)methyl]thiourea (PubChem CID 100683608) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is 1-[3-(2-oxopyrrolidin-1-yl)phenyl]-3-[(3,4,5-trimethoxyphenyl)methyl]thiourea.
| Compound Name | 1-[3-(2-oxopyrrolidin-1-yl)phenyl]-3-[(3,4,5-trimethoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 100683608 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 1-[3-(2-oxopyrrolidin-1-yl)phenyl]-3-[(3,4,5-trimethoxyphenyl)methyl]thiourea |
| SMILES | COc1cc(CNC(=S)Nc2cccc(N3CCCC3=O)c2)cc(OC)c1OC |
| InChI | InChI=1S/C21H25N3O4S/c1-26-17-10-14(11-18(27-2)20(17)28-3)13-22-21(29)23-15-6-4-7-16(12-15)24-9-5-8-19(24)25/h4,6-7,10-12H,5,8-9,13H2,1-3H3,(H2,22,23,29) |
| InChIKey | LGLZAEZRFLIBFM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|