C21H25N3O5 — CID 122075512
4-[[[3-[2-(diethylamino)-2-oxoethoxy]phenyl]carbamoylamino]methyl]benzoic acid (PubChem CID 122075512) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is 4-[[[3-[2-(diethylamino)-2-oxoethoxy]phenyl]carbamoylamino]methyl]benzoic acid.
| Compound Name | 4-[[[3-[2-(diethylamino)-2-oxoethoxy]phenyl]carbamoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122075512 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 4-[[[3-[2-(diethylamino)-2-oxoethoxy]phenyl]carbamoylamino]methyl]benzoic acid |
| SMILES | CCN(CC)C(=O)COc1cccc(NC(=O)NCc2ccc(C(=O)O)cc2)c1 |
| InChI | InChI=1S/C21H25N3O5/c1-3-24(4-2)19(25)14-29-18-7-5-6-17(12-18)23-21(28)22-13-15-8-10-16(11-9-15)20(26)27/h5-12H,3-4,13-14H2,1-2H3,(H,26,27)(H2,22,23,28) |
| InChIKey | MDWYRDJLMCIGIB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |