C19H21N3O5 — CID 119180474
6-[[3-[2-(diethylamino)-2-oxoethoxy]phenyl]carbamoyl]pyridine-2-carboxylic acid (PubChem CID 119180474) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is 6-[[3-[2-(diethylamino)-2-oxoethoxy]phenyl]carbamoyl]pyridine-2-carboxylic acid.
| Compound Name | 6-[[3-[2-(diethylamino)-2-oxoethoxy]phenyl]carbamoyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 119180474 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 6-[[3-[2-(diethylamino)-2-oxoethoxy]phenyl]carbamoyl]pyridine-2-carboxylic acid |
| SMILES | CCN(CC)C(=O)COc1cccc(NC(=O)c2cccc(C(=O)O)n2)c1 |
| InChI | InChI=1S/C19H21N3O5/c1-3-22(4-2)17(23)12-27-14-8-5-7-13(11-14)20-18(24)15-9-6-10-16(21-15)19(25)26/h5-11H,3-4,12H2,1-2H3,(H,20,24)(H,25,26) |
| InChIKey | AGIMRVZAJJNLLQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |