C15H25N3O2 — CID 117097567
2-[3-(3-aminopropylamino)phenoxy]-N,N-diethylacetamide (PubChem CID 117097567) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is 2-[3-(3-aminopropylamino)phenoxy]-N,N-diethylacetamide.
| Compound Name | 2-[3-(3-aminopropylamino)phenoxy]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 117097567 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 2-[3-(3-aminopropylamino)phenoxy]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)COc1cccc(NCCCN)c1 |
| InChI | InChI=1S/C15H25N3O2/c1-3-18(4-2)15(19)12-20-14-8-5-7-13(11-14)17-10-6-9-16/h5,7-8,11,17H,3-4,6,9-10,12,16H2,1-2H3 |
| InChIKey | VFRDVSSONOPFDJ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|