C20H23N3O3 — CID 109103893
5-N-benzyl-5-N-methyl-3-N-(oxolan-2-ylmethyl)pyridine-3,5-dicarboxamide (PubChem CID 109103893) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is 5-N-benzyl-5-N-methyl-3-N-(oxolan-2-ylmethyl)pyridine-3,5-dicarboxamide.
| Compound Name | 5-N-benzyl-5-N-methyl-3-N-(oxolan-2-ylmethyl)pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109103893 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 5-N-benzyl-5-N-methyl-3-N-(oxolan-2-ylmethyl)pyridine-3,5-dicarboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1cncc(C(=O)NCC2CCCO2)c1 |
| InChI | InChI=1S/C20H23N3O3/c1-23(14-15-6-3-2-4-7-15)20(25)17-10-16(11-21-12-17)19(24)22-13-18-8-5-9-26-18/h2-4,6-7,10-12,18H,5,8-9,13-14H2,1H3,(H,22,24) |
| InChIKey | VSVOULOZEXEHBV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |