C22H26N4O3 — CID 109103915
N-(oxolan-2-ylmethyl)-5-(4-phenylpiperazine-1-carbonyl)pyridine-3-carboxamide (PubChem CID 109103915) has the molecular formula C22H26N4O3 and a molecular weight of 394.47 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-5-(4-phenylpiperazine-1-carbonyl)pyridine-3-carboxamide.
| Compound Name | N-(oxolan-2-ylmethyl)-5-(4-phenylpiperazine-1-carbonyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109103915 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-5-(4-phenylpiperazine-1-carbonyl)pyridine-3-carboxamide |
| SMILES | O=C(NCC1CCCO1)c1cncc(C(=O)N2CCN(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C22H26N4O3/c27-21(24-16-20-7-4-12-29-20)17-13-18(15-23-14-17)22(28)26-10-8-25(9-11-26)19-5-2-1-3-6-19/h1-3,5-6,13-15,20H,4,7-12,16H2,(H,24,27) |
| InChIKey | ZWQHGFPXTBMKCH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |