C25H31N5O2 — CID 56512779
N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-N'-(2-cyanoethyl)-N'-phenylbutanediamide (PubChem CID 56512779) has the molecular formula C25H31N5O2 and a molecular weight of 433.56 g/mol. Its IUPAC name is N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-N'-(2-cyanoethyl)-N'-phenylbutanediamide.
| Compound Name | N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-N'-(2-cyanoethyl)-N'-phenylbutanediamide |
|---|---|
| PubChem CID | 56512779 |
| Molecular Formula | C25H31N5O2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-N'-(2-cyanoethyl)-N'-phenylbutanediamide |
| SMILES | N#CCCN(C(=O)CCC(=O)NCc1ccc(N2CCCCCC2)nc1)c1ccccc1 |
| InChI | InChI=1S/C25H31N5O2/c26-15-8-18-30(22-9-4-3-5-10-22)25(32)14-13-24(31)28-20-21-11-12-23(27-19-21)29-16-6-1-2-7-17-29/h3-5,9-12,19H,1-2,6-8,13-14,16-18,20H2,(H,28,31) |
| InChIKey | GREJZZLCGUUUAW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |