C17H19F2N3O2 — CID 51100451
1-(2,4-difluorophenyl)-3-[[4-(2-methoxyethylamino)phenyl]methyl]urea (PubChem CID 51100451) has the molecular formula C17H19F2N3O2 and a molecular weight of 335.35 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[[4-(2-methoxyethylamino)phenyl]methyl]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[[4-(2-methoxyethylamino)phenyl]methyl]urea |
|---|---|
| PubChem CID | 51100451 |
| Molecular Formula | C17H19F2N3O2 |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[[4-(2-methoxyethylamino)phenyl]methyl]urea |
| SMILES | COCCNc1ccc(CNC(=O)Nc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C17H19F2N3O2/c1-24-9-8-20-14-5-2-12(3-6-14)11-21-17(23)22-16-7-4-13(18)10-15(16)19/h2-7,10,20H,8-9,11H2,1H3,(H2,21,22,23) |
| InChIKey | XRVZJAVFNNAMJN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|