C13H14F2N2O3 — CID 113000825
N-[2-(2,4-difluoroanilino)-2-oxoethyl]oxolane-2-carboxamide (PubChem CID 113000825) has the molecular formula C13H14F2N2O3 and a molecular weight of 284.26 g/mol. Its IUPAC name is N-[2-(2,4-difluoroanilino)-2-oxoethyl]oxolane-2-carboxamide.
| Compound Name | N-[2-(2,4-difluoroanilino)-2-oxoethyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 113000825 |
| Molecular Formula | C13H14F2N2O3 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | N-[2-(2,4-difluoroanilino)-2-oxoethyl]oxolane-2-carboxamide |
| SMILES | O=C(CNC(=O)C1CCCO1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C13H14F2N2O3/c14-8-3-4-10(9(15)6-8)17-12(18)7-16-13(19)11-2-1-5-20-11/h3-4,6,11H,1-2,5,7H2,(H,16,19)(H,17,18) |
| InChIKey | GNSIHVBXNWYAKK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |