C14H18FN3O3 — CID 82034303
N-[2-(3-aminopropanoylamino)-4-fluorophenyl]oxolane-2-carboxamide (PubChem CID 82034303) has the molecular formula C14H18FN3O3 and a molecular weight of 295.31 g/mol. Its IUPAC name is N-[2-(3-aminopropanoylamino)-4-fluorophenyl]oxolane-2-carboxamide.
| Compound Name | N-[2-(3-aminopropanoylamino)-4-fluorophenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 82034303 |
| Molecular Formula | C14H18FN3O3 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | N-[2-(3-aminopropanoylamino)-4-fluorophenyl]oxolane-2-carboxamide |
| SMILES | NCCC(=O)Nc1cc(F)ccc1NC(=O)C1CCCO1 |
| InChI | InChI=1S/C14H18FN3O3/c15-9-3-4-10(11(8-9)17-13(19)5-6-16)18-14(20)12-2-1-7-21-12/h3-4,8,12H,1-2,5-7,16H2,(H,17,19)(H,18,20) |
| InChIKey | YHCRBCFTJYCSRI-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |