C17H32N2O3 — CID 111506485
1-(2-cycloheptyloxyethyl)-3-[2-(hydroxymethyl)-2-methylcyclopentyl]urea (PubChem CID 111506485) has the molecular formula C17H32N2O3 and a molecular weight of 312.45 g/mol. Its IUPAC name is 1-(2-cycloheptyloxyethyl)-3-[2-(hydroxymethyl)-2-methylcyclopentyl]urea.
| Compound Name | 1-(2-cycloheptyloxyethyl)-3-[2-(hydroxymethyl)-2-methylcyclopentyl]urea |
|---|---|
| PubChem CID | 111506485 |
| Molecular Formula | C17H32N2O3 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.24 |
| IUPAC Name | 1-(2-cycloheptyloxyethyl)-3-[2-(hydroxymethyl)-2-methylcyclopentyl]urea |
| SMILES | CC1(CO)CCCC1NC(=O)NCCOC1CCCCCC1 |
| InChI | InChI=1S/C17H32N2O3/c1-17(13-20)10-6-9-15(17)19-16(21)18-11-12-22-14-7-4-2-3-5-8-14/h14-15,20H,2-13H2,1H3,(H2,18,19,21) |
| InChIKey | JXDLHCOBTALCJH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|