C22H33N3O4 — CID 51941848
tert-butyl (3R)-3-[(2-cyclopentyloxy-3-pyridinyl)methylcarbamoyl]piperidine-1-carboxylate (PubChem CID 51941848) has the molecular formula C22H33N3O4 and a molecular weight of 403.52 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(2-cyclopentyloxy-3-pyridinyl)methylcarbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(2-cyclopentyloxy-3-pyridinyl)methylcarbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 51941848 |
| Molecular Formula | C22H33N3O4 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | tert-butyl (3R)-3-[(2-cyclopentyloxy-3-pyridinyl)methylcarbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](C(=O)NCc2cccnc2OC2CCCC2)C1 |
| InChI | InChI=1S/C22H33N3O4/c1-22(2,3)29-21(27)25-13-7-9-17(15-25)19(26)24-14-16-8-6-12-23-20(16)28-18-10-4-5-11-18/h6,8,12,17-18H,4-5,7,9-11,13-15H2,1-3H3,(H,24,26)/t17-/m1/s1 |
| InChIKey | GIKKOYFNVMWGCC-QGZVFWFLSA-N |
| XLogP | 3.67 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |