C14H16FN3O3 — CID 174516227
N-[[1-(4-fluorobenzoyl)piperidine-3-carbonyl]amino]formamide (PubChem CID 174516227) has the molecular formula C14H16FN3O3 and a molecular weight of 293.30 g/mol. Its IUPAC name is N-[[1-(4-fluorobenzoyl)piperidine-3-carbonyl]amino]formamide.
| Compound Name | N-[[1-(4-fluorobenzoyl)piperidine-3-carbonyl]amino]formamide |
|---|---|
| PubChem CID | 174516227 |
| Molecular Formula | C14H16FN3O3 |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-[[1-(4-fluorobenzoyl)piperidine-3-carbonyl]amino]formamide |
| SMILES | O=CNNC(=O)C1CCCN(C(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C14H16FN3O3/c15-12-5-3-10(4-6-12)14(21)18-7-1-2-11(8-18)13(20)17-16-9-19/h3-6,9,11H,1-2,7-8H2,(H,16,19)(H,17,20) |
| InChIKey | OSXTYHBJOXDNMT-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|