C18H25N3O2 — CID 119412708
[(3R)-3-aminopyrrolidin-1-yl]-[1-(4-methylbenzoyl)piperidin-3-yl]methanone (PubChem CID 119412708) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is [(3R)-3-aminopyrrolidin-1-yl]-[1-(4-methylbenzoyl)piperidin-3-yl]methanone.
| Compound Name | [(3R)-3-aminopyrrolidin-1-yl]-[1-(4-methylbenzoyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 119412708 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | [(3R)-3-aminopyrrolidin-1-yl]-[1-(4-methylbenzoyl)piperidin-3-yl]methanone |
| SMILES | Cc1ccc(C(=O)N2CCCC(C(=O)N3CC[C@@H](N)C3)C2)cc1 |
| InChI | InChI=1S/C18H25N3O2/c1-13-4-6-14(7-5-13)17(22)20-9-2-3-15(11-20)18(23)21-10-8-16(19)12-21/h4-7,15-16H,2-3,8-12,19H2,1H3/t15?,16-/m1/s1 |
| InChIKey | MLKXLTRZCKJFKO-OEMAIJDKSA-N |
| XLogP | 1.41 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |