C20H28ClN3O2 — CID 120656131
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[1-(4-methylbenzoyl)piperidin-3-yl]methanone;hydrochloride (PubChem CID 120656131) has the molecular formula C20H28ClN3O2 and a molecular weight of 377.92 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[1-(4-methylbenzoyl)piperidin-3-yl]methanone;hydrochloride.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[1-(4-methylbenzoyl)piperidin-3-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120656131 |
| Molecular Formula | C20H28ClN3O2 |
| Molecular Weight | 377.92 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[1-(4-methylbenzoyl)piperidin-3-yl]methanone;hydrochloride |
| SMILES | Cc1ccc(C(=O)N2CCCC(C(=O)N3C[C@H]4CNC[C@H]4C3)C2)cc1.Cl |
| InChI | InChI=1S/C20H27N3O2.ClH/c1-14-4-6-15(7-5-14)19(24)22-8-2-3-16(11-22)20(25)23-12-17-9-21-10-18(17)13-23;/h4-7,16-18,21H,2-3,8-13H2,1H3;1H/t16?,17-,18+; |
| InChIKey | FBMLHDJARAEZDB-KUZYQSSXSA-N |
| XLogP | 1.95 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.92 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |