C20H28N2O3 — CID 139006941
(3-hydroxy-3-propan-2-ylazetidin-1-yl)-[1-(4-methylbenzoyl)piperidin-3-yl]methanone (PubChem CID 139006941) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is (3-hydroxy-3-propan-2-ylazetidin-1-yl)-[1-(4-methylbenzoyl)piperidin-3-yl]methanone.
| Compound Name | (3-hydroxy-3-propan-2-ylazetidin-1-yl)-[1-(4-methylbenzoyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 139006941 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | (3-hydroxy-3-propan-2-ylazetidin-1-yl)-[1-(4-methylbenzoyl)piperidin-3-yl]methanone |
| SMILES | Cc1ccc(C(=O)N2CCCC(C(=O)N3CC(O)(C(C)C)C3)C2)cc1 |
| InChI | InChI=1S/C20H28N2O3/c1-14(2)20(25)12-22(13-20)19(24)17-5-4-10-21(11-17)18(23)16-8-6-15(3)7-9-16/h6-9,14,17,25H,4-5,10-13H2,1-3H3 |
| InChIKey | UTJDHNANKLHAAG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |