C20H27N3O3 — CID 139002759
1-ethyl-4-[1-(4-methylbenzoyl)piperidine-3-carbonyl]piperazin-2-one (PubChem CID 139002759) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 1-ethyl-4-[1-(4-methylbenzoyl)piperidine-3-carbonyl]piperazin-2-one.
| Compound Name | 1-ethyl-4-[1-(4-methylbenzoyl)piperidine-3-carbonyl]piperazin-2-one |
|---|---|
| PubChem CID | 139002759 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 1-ethyl-4-[1-(4-methylbenzoyl)piperidine-3-carbonyl]piperazin-2-one |
| SMILES | CCN1CCN(C(=O)C2CCCN(C(=O)c3ccc(C)cc3)C2)CC1=O |
| InChI | InChI=1S/C20H27N3O3/c1-3-21-11-12-23(14-18(21)24)20(26)17-5-4-10-22(13-17)19(25)16-8-6-15(2)7-9-16/h6-9,17H,3-5,10-14H2,1-2H3 |
| InChIKey | ZANVEWMUSXRTAM-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |