C18H21NO3S — CID 47055994
N-(3-benzylsulfonylpropyl)-2-methylbenzamide (PubChem CID 47055994) has the molecular formula C18H21NO3S and a molecular weight of 331.44 g/mol. Its IUPAC name is N-(3-benzylsulfonylpropyl)-2-methylbenzamide.
| Compound Name | N-(3-benzylsulfonylpropyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 47055994 |
| Molecular Formula | C18H21NO3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | N-(3-benzylsulfonylpropyl)-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)NCCCS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C18H21NO3S/c1-15-8-5-6-11-17(15)18(20)19-12-7-13-23(21,22)14-16-9-3-2-4-10-16/h2-6,8-11H,7,12-14H2,1H3,(H,19,20) |
| InChIKey | RFQSSZWLAYAJAY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|