C18H25NO5S — CID 120672800
4-(3-benzylsulfonylpropylcarbamoyl)cyclohexane-1-carboxylic acid (PubChem CID 120672800) has the molecular formula C18H25NO5S and a molecular weight of 367.47 g/mol. Its IUPAC name is 4-(3-benzylsulfonylpropylcarbamoyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-(3-benzylsulfonylpropylcarbamoyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120672800 |
| Molecular Formula | C18H25NO5S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 4-(3-benzylsulfonylpropylcarbamoyl)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)NCCCS(=O)(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H25NO5S/c20-17(15-7-9-16(10-8-15)18(21)22)19-11-4-12-25(23,24)13-14-5-2-1-3-6-14/h1-3,5-6,15-16H,4,7-13H2,(H,19,20)(H,21,22) |
| InChIKey | GHUDDXUBSGKYJM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|