C18H27ClN2O3S — CID 119727947
3-amino-N-(3-benzylsulfonylpropyl)bicyclo[2.2.1]heptane-2-carboxamide;hydrochloride (PubChem CID 119727947) has the molecular formula C18H27ClN2O3S and a molecular weight of 386.95 g/mol. Its IUPAC name is 3-amino-N-(3-benzylsulfonylpropyl)bicyclo[2.2.1]heptane-2-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-(3-benzylsulfonylpropyl)bicyclo[2.2.1]heptane-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119727947 |
| Molecular Formula | C18H27ClN2O3S |
| Molecular Weight | 386.95 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 3-amino-N-(3-benzylsulfonylpropyl)bicyclo[2.2.1]heptane-2-carboxamide;hydrochloride |
| SMILES | Cl.NC1C2CCC(C2)C1C(=O)NCCCS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C18H26N2O3S.ClH/c19-17-15-8-7-14(11-15)16(17)18(21)20-9-4-10-24(22,23)12-13-5-2-1-3-6-13;/h1-3,5-6,14-17H,4,7-12,19H2,(H,20,21);1H |
| InChIKey | QPCYMFQUECBJNV-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.95 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|