C17H25ClN2O — CID 119745498
3-amino-N-[2-(3-methylphenyl)ethyl]bicyclo[2.2.1]heptane-2-carboxamide;hydrochloride (PubChem CID 119745498) has the molecular formula C17H25ClN2O and a molecular weight of 308.85 g/mol. Its IUPAC name is 3-amino-N-[2-(3-methylphenyl)ethyl]bicyclo[2.2.1]heptane-2-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-[2-(3-methylphenyl)ethyl]bicyclo[2.2.1]heptane-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119745498 |
| Molecular Formula | C17H25ClN2O |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 3-amino-N-[2-(3-methylphenyl)ethyl]bicyclo[2.2.1]heptane-2-carboxamide;hydrochloride |
| SMILES | Cc1cccc(CCNC(=O)C2C3CCC(C3)C2N)c1.Cl |
| InChI | InChI=1S/C17H24N2O.ClH/c1-11-3-2-4-12(9-11)7-8-19-17(20)15-13-5-6-14(10-13)16(15)18;/h2-4,9,13-16H,5-8,10,18H2,1H3,(H,19,20);1H |
| InChIKey | RUCLYVVZJNPQIZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |