C18H25ClFN3O2 — CID 119704114
3-amino-N-[2-[(3-fluoro-4-methylbenzoyl)amino]ethyl]bicyclo[2.2.1]heptane-2-carboxamide;hydrochloride (PubChem CID 119704114) has the molecular formula C18H25ClFN3O2 and a molecular weight of 369.87 g/mol. Its IUPAC name is 3-amino-N-[2-[(3-fluoro-4-methylbenzoyl)amino]ethyl]bicyclo[2.2.1]heptane-2-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-[2-[(3-fluoro-4-methylbenzoyl)amino]ethyl]bicyclo[2.2.1]heptane-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119704114 |
| Molecular Formula | C18H25ClFN3O2 |
| Molecular Weight | 369.87 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 3-amino-N-[2-[(3-fluoro-4-methylbenzoyl)amino]ethyl]bicyclo[2.2.1]heptane-2-carboxamide;hydrochloride |
| SMILES | Cc1ccc(C(=O)NCCNC(=O)C2C3CCC(C3)C2N)cc1F.Cl |
| InChI | InChI=1S/C18H24FN3O2.ClH/c1-10-2-3-13(9-14(10)19)17(23)21-6-7-22-18(24)15-11-4-5-12(8-11)16(15)20;/h2-3,9,11-12,15-16H,4-8,20H2,1H3,(H,21,23)(H,22,24);1H |
| InChIKey | RXRGVVDDYIIPLM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.87 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|