C17H23BrClN3O2 — CID 119765631
3-amino-N-[2-[(3-bromobenzoyl)amino]ethyl]bicyclo[2.2.1]heptane-2-carboxamide;hydrochloride (PubChem CID 119765631) has the molecular formula C17H23BrClN3O2 and a molecular weight of 416.75 g/mol. Its IUPAC name is 3-amino-N-[2-[(3-bromobenzoyl)amino]ethyl]bicyclo[2.2.1]heptane-2-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-[2-[(3-bromobenzoyl)amino]ethyl]bicyclo[2.2.1]heptane-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119765631 |
| Molecular Formula | C17H23BrClN3O2 |
| Molecular Weight | 416.75 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | 3-amino-N-[2-[(3-bromobenzoyl)amino]ethyl]bicyclo[2.2.1]heptane-2-carboxamide;hydrochloride |
| SMILES | Cl.NC1C2CCC(C2)C1C(=O)NCCNC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C17H22BrN3O2.ClH/c18-13-3-1-2-12(9-13)16(22)20-6-7-21-17(23)14-10-4-5-11(8-10)15(14)19;/h1-3,9-11,14-15H,4-8,19H2,(H,20,22)(H,21,23);1H |
| InChIKey | UMPCAPNUNBMJMF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.75 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|