C15H20BrN3O3 — CID 120791324
(2S,5R)-5-(aminomethyl)-N-[2-[(3-bromobenzoyl)amino]ethyl]oxolane-2-carboxamide (PubChem CID 120791324) has the molecular formula C15H20BrN3O3 and a molecular weight of 370.25 g/mol. Its IUPAC name is (2S,5R)-5-(aminomethyl)-N-[2-[(3-bromobenzoyl)amino]ethyl]oxolane-2-carboxamide.
| Compound Name | (2S,5R)-5-(aminomethyl)-N-[2-[(3-bromobenzoyl)amino]ethyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 120791324 |
| Molecular Formula | C15H20BrN3O3 |
| Molecular Weight | 370.25 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | (2S,5R)-5-(aminomethyl)-N-[2-[(3-bromobenzoyl)amino]ethyl]oxolane-2-carboxamide |
| SMILES | NC[C@H]1CC[C@@H](C(=O)NCCNC(=O)c2cccc(Br)c2)O1 |
| InChI | InChI=1S/C15H20BrN3O3/c16-11-3-1-2-10(8-11)14(20)18-6-7-19-15(21)13-5-4-12(9-17)22-13/h1-3,8,12-13H,4-7,9,17H2,(H,18,20)(H,19,21)/t12-,13+/m1/s1 |
| InChIKey | KAQUKWAUNNHULI-OLZOCXBDSA-N |
| XLogP | 0.80 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.25 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|