C18H24FN3O2 — CID 119704115
3-amino-N-[2-[(3-fluoro-4-methylbenzoyl)amino]ethyl]bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 119704115) has the molecular formula C18H24FN3O2 and a molecular weight of 333.41 g/mol. Its IUPAC name is 3-amino-N-[2-[(3-fluoro-4-methylbenzoyl)amino]ethyl]bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | 3-amino-N-[2-[(3-fluoro-4-methylbenzoyl)amino]ethyl]bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 119704115 |
| Molecular Formula | C18H24FN3O2 |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 3-amino-N-[2-[(3-fluoro-4-methylbenzoyl)amino]ethyl]bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NCCNC(=O)C2C3CCC(C3)C2N)cc1F |
| InChI | InChI=1S/C18H24FN3O2/c1-10-2-3-13(9-14(10)19)17(23)21-6-7-22-18(24)15-11-4-5-12(8-11)16(15)20/h2-3,9,11-12,15-16H,4-8,20H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | ZSVOOLQOJVJWAF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|